C24H25N3O4 — CID 172660883
methyl 2-[[(3aS,5R,6R,7aR)-6-hydroxy-2-(1,6-naphthyridin-5-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate (PubChem CID 172660883) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is methyl 2-[[(3aS,5R,6R,7aR)-6-hydroxy-2-(1,6-naphthyridin-5-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate.
| Compound Name | methyl 2-[[(3aS,5R,6R,7aR)-6-hydroxy-2-(1,6-naphthyridin-5-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
|---|---|
| PubChem CID | 172660883 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | methyl 2-[[(3aS,5R,6R,7aR)-6-hydroxy-2-(1,6-naphthyridin-5-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]oxy]benzoate |
| SMILES | COC(=O)c1ccccc1O[C@@H]1C[C@@H]2CN(c3nccc4ncccc34)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C24H25N3O4/c1-30-24(29)18-5-2-3-7-21(18)31-22-12-16-14-27(13-15(16)11-20(22)28)23-17-6-4-9-25-19(17)8-10-26-23/h2-10,15-16,20,22,28H,11-14H2,1H3/t15-,16+,20+,22+/m0/s1 |
| InChIKey | LJNFJMKYYQUGMF-KUNVHTHFSA-N |
| XLogP | 3.07 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |