C26H30N2O4 — CID 172657465
(3aR,5R,6R,7aS)-6-(2-methoxyphenoxy)-2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172657465) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(2-methoxyphenoxy)-2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(2-methoxyphenoxy)-2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172657465 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(2-methoxyphenoxy)-2-[[3-(4-methylphenyl)-1,2-oxazol-5-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(Cc3cc(-c4ccc(C)cc4)no3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C26H30N2O4/c1-17-7-9-18(10-8-17)22-13-21(32-27-22)16-28-14-19-11-23(29)26(12-20(19)15-28)31-25-6-4-3-5-24(25)30-2/h3-10,13,19-20,23,26,29H,11-12,14-16H2,1-2H3/t19-,20+,23+,26+/m0/s1 |
| InChIKey | KOPOBFCQVCJDNU-XOKJFZFGSA-N |
| XLogP | 4.31 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |