C23H28ClNO5 — CID 172911221
(3aR,5R,6R,7aS)-2-[(3-chlorophenyl)methyl]-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid (PubChem CID 172911221) has the molecular formula C23H28ClNO5 and a molecular weight of 433.93 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(3-chlorophenyl)methyl]-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid.
| Compound Name | (3aR,5R,6R,7aS)-2-[(3-chlorophenyl)methyl]-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid |
|---|---|
| PubChem CID | 172911221 |
| Molecular Formula | C23H28ClNO5 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(3-chlorophenyl)methyl]-6-(2-methoxyphenoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid |
| SMILES | COc1ccccc1O[C@@H]1C[C@@H]2CN(Cc3cccc(Cl)c3)C[C@@H]2C[C@H]1O.O=CO |
| InChI | InChI=1S/C22H26ClNO3.CH2O2/c1-26-20-7-2-3-8-21(20)27-22-11-17-14-24(13-16(17)10-19(22)25)12-15-5-4-6-18(23)9-15;2-1-3/h2-9,16-17,19,22,25H,10-14H2,1H3;1H,(H,2,3)/t16-,17+,19+,22+;/m0./s1 |
| InChIKey | JRYYIBSPIJCVFX-XPFXJDLDSA-N |
| XLogP | 3.70 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|