C20H30N2O5 — CID 172911696
N-[(3aS,5R,6R,7aR)-6-methoxy-2-[(3-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide;formic acid (PubChem CID 172911696) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-6-methoxy-2-[(3-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide;formic acid.
| Compound Name | N-[(3aS,5R,6R,7aR)-6-methoxy-2-[(3-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide;formic acid |
|---|---|
| PubChem CID | 172911696 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-6-methoxy-2-[(3-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide;formic acid |
| SMILES | COc1cccc(CN2C[C@H]3C[C@@H](NC(C)=O)[C@H](OC)C[C@H]3C2)c1.O=CO |
| InChI | InChI=1S/C19H28N2O3.CH2O2/c1-13(22)20-18-8-15-11-21(12-16(15)9-19(18)24-3)10-14-5-4-6-17(7-14)23-2;2-1-3/h4-7,15-16,18-19H,8-12H2,1-3H3,(H,20,22);1H,(H,2,3)/t15-,16+,18-,19-;/m1./s1 |
| InChIKey | HPVFVUFJLKXWDU-LJBKODRFSA-N |
| XLogP | 1.76 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|