C25H31N3O2 — CID 171156032
1-[(3aR,5S,6S,7aS)-6-methoxy-2-[(3-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-methylbenzimidazole (PubChem CID 171156032) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,7aS)-6-methoxy-2-[(3-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-methylbenzimidazole.
| Compound Name | 1-[(3aR,5S,6S,7aS)-6-methoxy-2-[(3-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 171156032 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 1-[(3aR,5S,6S,7aS)-6-methoxy-2-[(3-methoxyphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-methylbenzimidazole |
| SMILES | COc1cccc(CN2C[C@H]3C[C@H](OC)[C@@H](n4c(C)nc5ccccc54)C[C@H]3C2)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-17-26-22-9-4-5-10-23(22)28(17)24-12-19-15-27(16-20(19)13-25(24)30-3)14-18-7-6-8-21(11-18)29-2/h4-11,19-20,24-25H,12-16H2,1-3H3/t19-,20+,24-,25-/m0/s1 |
| InChIKey | BPDYYRNMSCMOSX-IKVMQTKTSA-N |
| XLogP | 4.45 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |