C21H25N3O6 — CID 155876958
(3aR,6aS)-2-[(3-methoxyphenyl)methyl]-5-pyridin-3-yl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;formic acid (PubChem CID 155876958) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is (3aR,6aS)-2-[(3-methoxyphenyl)methyl]-5-pyridin-3-yl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;formic acid.
| Compound Name | (3aR,6aS)-2-[(3-methoxyphenyl)methyl]-5-pyridin-3-yl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;formic acid |
|---|---|
| PubChem CID | 155876958 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (3aR,6aS)-2-[(3-methoxyphenyl)methyl]-5-pyridin-3-yl-3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-4-one;formic acid |
| SMILES | COc1cccc(CN2C[C@H]3CN(c4cccnc4)C(=O)[C@H]3C2)c1.O=CO.O=CO |
| InChI | InChI=1S/C19H21N3O2.2CH2O2/c1-24-17-6-2-4-14(8-17)10-21-11-15-12-22(19(23)18(15)13-21)16-5-3-7-20-9-16;2*2-1-3/h2-9,15,18H,10-13H2,1H3;2*1H,(H,2,3)/t15-,18-;;/m0../s1 |
| InChIKey | YOICEXJFDPYSHE-WQPBPYDNSA-N |
| XLogP | 1.59 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|