C25H31N3O2 — CID 92621448
(6S)-1-[(3-methoxyphenyl)methyl]-6-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-5,6-dihydro-2H-azepin-7-one (PubChem CID 92621448) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (6S)-1-[(3-methoxyphenyl)methyl]-6-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-5,6-dihydro-2H-azepin-7-one.
| Compound Name | (6S)-1-[(3-methoxyphenyl)methyl]-6-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-5,6-dihydro-2H-azepin-7-one |
|---|---|
| PubChem CID | 92621448 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (6S)-1-[(3-methoxyphenyl)methyl]-6-[1-(pyridin-3-ylmethyl)piperidin-4-yl]-5,6-dihydro-2H-azepin-7-one |
| SMILES | COc1cccc(CN2CC=CC[C@@H](C3CCN(Cc4cccnc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-30-23-8-4-6-20(16-23)19-28-13-3-2-9-24(25(28)29)22-10-14-27(15-11-22)18-21-7-5-12-26-17-21/h2-8,12,16-17,22,24H,9-11,13-15,18-19H2,1H3/t24-/m0/s1 |
| InChIKey | YYSPAECSZYLFTE-DEOSSOPVSA-N |
| XLogP | 3.91 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|