C21H24ClNO3S — CID 172660804
1-[4-[[(3aS,5R,6R,7aR)-5-(3-chlorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]thiophen-2-yl]ethanone (PubChem CID 172660804) has the molecular formula C21H24ClNO3S and a molecular weight of 405.95 g/mol. Its IUPAC name is 1-[4-[[(3aS,5R,6R,7aR)-5-(3-chlorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[[(3aS,5R,6R,7aR)-5-(3-chlorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 172660804 |
| Molecular Formula | C21H24ClNO3S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-[4-[[(3aS,5R,6R,7aR)-5-(3-chlorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(CN2C[C@H]3C[C@@H](Oc4cccc(Cl)c4)[C@H](O)C[C@H]3C2)cs1 |
| InChI | InChI=1S/C21H24ClNO3S/c1-13(24)21-5-14(12-27-21)9-23-10-15-6-19(25)20(7-16(15)11-23)26-18-4-2-3-17(22)8-18/h2-5,8,12,15-16,19-20,25H,6-7,9-11H2,1H3/t15-,16+,19+,20+/m0/s1 |
| InChIKey | FQEZABMICSDUCN-LNKGRISISA-N |
| XLogP | 4.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |