C19H27ClN2O5 — CID 172912657
1-[(3aS,5R,6R,7aR)-5-(3-chlorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(dimethylamino)ethanone;formic acid (PubChem CID 172912657) has the molecular formula C19H27ClN2O5 and a molecular weight of 398.89 g/mol. Its IUPAC name is 1-[(3aS,5R,6R,7aR)-5-(3-chlorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(dimethylamino)ethanone;formic acid.
| Compound Name | 1-[(3aS,5R,6R,7aR)-5-(3-chlorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(dimethylamino)ethanone;formic acid |
|---|---|
| PubChem CID | 172912657 |
| Molecular Formula | C19H27ClN2O5 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-[(3aS,5R,6R,7aR)-5-(3-chlorophenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-(dimethylamino)ethanone;formic acid |
| SMILES | CN(C)CC(=O)N1C[C@H]2C[C@@H](Oc3cccc(Cl)c3)[C@H](O)C[C@H]2C1.O=CO |
| InChI | InChI=1S/C18H25ClN2O3.CH2O2/c1-20(2)11-18(23)21-9-12-6-16(22)17(7-13(12)10-21)24-15-5-3-4-14(19)8-15;2-1-3/h3-5,8,12-13,16-17,22H,6-7,9-11H2,1-2H3;1H,(H,2,3)/t12-,13+,16+,17+;/m0./s1 |
| InChIKey | JCSBMPYXIXAPNX-PHSCDZGSSA-N |
| XLogP | 1.58 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|