C24H30ClNO5 — CID 172912552
(3aR,5R,6R,7aS)-6-(3-chlorophenoxy)-2-(2-phenylmethoxyethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid (PubChem CID 172912552) has the molecular formula C24H30ClNO5 and a molecular weight of 447.96 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(3-chlorophenoxy)-2-(2-phenylmethoxyethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid.
| Compound Name | (3aR,5R,6R,7aS)-6-(3-chlorophenoxy)-2-(2-phenylmethoxyethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid |
|---|---|
| PubChem CID | 172912552 |
| Molecular Formula | C24H30ClNO5 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(3-chlorophenoxy)-2-(2-phenylmethoxyethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid |
| SMILES | O=CO.O[C@@H]1C[C@H]2CN(CCOCc3ccccc3)C[C@H]2C[C@H]1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H28ClNO3.CH2O2/c24-20-7-4-8-21(13-20)28-23-12-19-15-25(14-18(19)11-22(23)26)9-10-27-16-17-5-2-1-3-6-17;2-1-3/h1-8,13,18-19,22-23,26H,9-12,14-16H2;1H,(H,2,3)/t18-,19+,22+,23+;/m0./s1 |
| InChIKey | NKFLONLRRMHGPT-JFHGCCTISA-N |
| XLogP | 3.71 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|