C22H26ClN3O2 — CID 172655295
N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(pyridin-3-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-(3-chlorophenyl)acetamide (PubChem CID 172655295) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(pyridin-3-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-(3-chlorophenyl)acetamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(pyridin-3-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 172655295 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-(pyridin-3-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-2-(3-chlorophenyl)acetamide |
| SMILES | O=C(Cc1cccc(Cl)c1)N[C@H]1C[C@H]2CN(Cc3cccnc3)C[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C22H26ClN3O2/c23-19-5-1-3-15(7-19)8-22(28)25-20-9-17-13-26(14-18(17)10-21(20)27)12-16-4-2-6-24-11-16/h1-7,11,17-18,20-21,27H,8-10,12-14H2,(H,25,28)/t17-,18+,20-,21-/m0/s1 |
| InChIKey | WABGRROFMMJOTB-YHELAOLJSA-N |
| XLogP | 2.67 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |