C21H24ClN3O5 — CID 163341831
(1S,3R,4R)-3-[[2-(4-chlorophenyl)acetyl]amino]-4-hydroxy-N-(pyridin-3-ylmethyl)cyclopentane-1-carboxamide;formic acid (PubChem CID 163341831) has the molecular formula C21H24ClN3O5 and a molecular weight of 433.89 g/mol. Its IUPAC name is (1S,3R,4R)-3-[[2-(4-chlorophenyl)acetyl]amino]-4-hydroxy-N-(pyridin-3-ylmethyl)cyclopentane-1-carboxamide;formic acid.
| Compound Name | (1S,3R,4R)-3-[[2-(4-chlorophenyl)acetyl]amino]-4-hydroxy-N-(pyridin-3-ylmethyl)cyclopentane-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 163341831 |
| Molecular Formula | C21H24ClN3O5 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (1S,3R,4R)-3-[[2-(4-chlorophenyl)acetyl]amino]-4-hydroxy-N-(pyridin-3-ylmethyl)cyclopentane-1-carboxamide;formic acid |
| SMILES | O=C(Cc1ccc(Cl)cc1)N[C@@H]1C[C@H](C(=O)NCc2cccnc2)C[C@H]1O.O=CO |
| InChI | InChI=1S/C20H22ClN3O3.CH2O2/c21-16-5-3-13(4-6-16)8-19(26)24-17-9-15(10-18(17)25)20(27)23-12-14-2-1-7-22-11-14;2-1-3/h1-7,11,15,17-18,25H,8-10,12H2,(H,23,27)(H,24,26);1H,(H,2,3)/t15-,17+,18+;/m0./s1 |
| InChIKey | ZNIJFKCGSXJQMS-FLCXFYETSA-N |
| XLogP | 1.55 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|