C19H26N2O4 — CID 172657166
2-[4-[[(3aS,5R,6R,7aR)-5-acetamido-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]phenyl]acetic acid (PubChem CID 172657166) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-[4-[[(3aS,5R,6R,7aR)-5-acetamido-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[(3aS,5R,6R,7aR)-5-acetamido-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 172657166 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[4-[[(3aS,5R,6R,7aR)-5-acetamido-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]phenyl]acetic acid |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2CN(Cc3ccc(CC(=O)O)cc3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C19H26N2O4/c1-12(22)20-17-7-15-10-21(11-16(15)8-18(17)23)9-14-4-2-13(3-5-14)6-19(24)25/h2-5,15-18,23H,6-11H2,1H3,(H,20,22)(H,24,25)/t15-,16+,17-,18-/m1/s1 |
| InChIKey | KGDNFMVYRIZTHW-XMTFNYHQSA-N |
| XLogP | 1.02 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |