C18H24N4O3 — CID 172665468
N-[(3aS,5R,6R,7aR)-6-hydroxy-2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172665468) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-6-hydroxy-2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-6-hydroxy-2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172665468 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-6-hydroxy-2-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2CN(Cc3ccc(-c4ccn[nH]4)o3)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C18H24N4O3/c1-11(23)20-16-6-12-8-22(9-13(12)7-17(16)24)10-14-2-3-18(25-14)15-4-5-19-21-15/h2-5,12-13,16-17,24H,6-10H2,1H3,(H,19,21)(H,20,23)/t12-,13+,16-,17-/m1/s1 |
| InChIKey | WKNFGQLBDSNHEZ-DLTLXFJOSA-N |
| XLogP | 1.38 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |