C21H30N2O5 — CID 172661696
methyl 5-[[(3aS,5R,6R,7aR)-5-acetamido-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]furan-2-carboxylate (PubChem CID 172661696) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is methyl 5-[[(3aS,5R,6R,7aR)-5-acetamido-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(3aS,5R,6R,7aR)-5-acetamido-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 172661696 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | methyl 5-[[(3aS,5R,6R,7aR)-5-acetamido-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CN2C[C@H]3C[C@@H](NC(C)=O)[C@H](OCC4CC4)C[C@H]3C2)o1 |
| InChI | InChI=1S/C21H30N2O5/c1-13(24)22-18-7-15-9-23(11-17-5-6-19(28-17)21(25)26-2)10-16(15)8-20(18)27-12-14-3-4-14/h5-6,14-16,18,20H,3-4,7-12H2,1-2H3,(H,22,24)/t15-,16+,18-,20-/m1/s1 |
| InChIKey | SHGDHWDCBSGQRZ-YNVMFWSZSA-N |
| XLogP | 2.21 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |