C20H26N4O2 — CID 70785582
(1S,5R)-6-(3-methylbut-2-enyl)-3-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-3,6-diazabicyclo[3.2.2]nonan-7-one (PubChem CID 70785582) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1S,5R)-6-(3-methylbut-2-enyl)-3-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-3,6-diazabicyclo[3.2.2]nonan-7-one.
| Compound Name | (1S,5R)-6-(3-methylbut-2-enyl)-3-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-3,6-diazabicyclo[3.2.2]nonan-7-one |
|---|---|
| PubChem CID | 70785582 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (1S,5R)-6-(3-methylbut-2-enyl)-3-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]-3,6-diazabicyclo[3.2.2]nonan-7-one |
| SMILES | CC(C)=CCN1C(=O)[C@H]2CC[C@@H]1CN(Cc1ccc(-c3ccn[nH]3)o1)C2 |
| InChI | InChI=1S/C20H26N4O2/c1-14(2)8-10-24-16-4-3-15(20(24)25)11-23(12-16)13-17-5-6-19(26-17)18-7-9-21-22-18/h5-9,15-16H,3-4,10-13H2,1-2H3,(H,21,22)/t15-,16+/m0/s1 |
| InChIKey | VHHGVJFLGVBWJR-JKSUJKDBSA-N |
| XLogP | 3.06 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|