C17H22N4O2 — CID 74231008
1-cyclopentyl-4-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]piperazin-2-one (PubChem CID 74231008) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-cyclopentyl-4-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]piperazin-2-one.
| Compound Name | 1-cyclopentyl-4-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 74231008 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-cyclopentyl-4-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2ccc(-c3ccn[nH]3)o2)CCN1C1CCCC1 |
| InChI | InChI=1S/C17H22N4O2/c22-17-12-20(9-10-21(17)13-3-1-2-4-13)11-14-5-6-16(23-14)15-7-8-18-19-15/h5-8,13H,1-4,9-12H2,(H,18,19) |
| InChIKey | IWKZJVWVMHLQAU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |