C15H20N4O3 — CID 91786548
ethyl 4-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]piperazine-1-carboxylate (PubChem CID 91786548) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl 4-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 91786548 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | ethyl 4-[[5-(1H-pyrazol-5-yl)furan-2-yl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2ccc(-c3ccn[nH]3)o2)CC1 |
| InChI | InChI=1S/C15H20N4O3/c1-2-21-15(20)19-9-7-18(8-10-19)11-12-3-4-14(22-12)13-5-6-16-17-13/h3-6H,2,7-11H2,1H3,(H,16,17) |
| InChIKey | VEJAEAFRUXRHNG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |