C22H28N4O — CID 72881211
(1S,5R)-6-(3-methylbut-2-enyl)-3-[(3-pyrazol-1-ylphenyl)methyl]-3,6-diazabicyclo[3.2.2]nonan-7-one (PubChem CID 72881211) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (1S,5R)-6-(3-methylbut-2-enyl)-3-[(3-pyrazol-1-ylphenyl)methyl]-3,6-diazabicyclo[3.2.2]nonan-7-one.
| Compound Name | (1S,5R)-6-(3-methylbut-2-enyl)-3-[(3-pyrazol-1-ylphenyl)methyl]-3,6-diazabicyclo[3.2.2]nonan-7-one |
|---|---|
| PubChem CID | 72881211 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (1S,5R)-6-(3-methylbut-2-enyl)-3-[(3-pyrazol-1-ylphenyl)methyl]-3,6-diazabicyclo[3.2.2]nonan-7-one |
| SMILES | CC(C)=CCN1C(=O)[C@H]2CC[C@@H]1CN(Cc1cccc(-n3cccn3)c1)C2 |
| InChI | InChI=1S/C22H28N4O/c1-17(2)9-12-25-21-8-7-19(22(25)27)15-24(16-21)14-18-5-3-6-20(13-18)26-11-4-10-23-26/h3-6,9-11,13,19,21H,7-8,12,14-16H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | KCMTWWBHCGMQJT-PZJWPPBQSA-N |
| XLogP | 3.26 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|