C20H28N4 — CID 70735219
1-cyclopentyl-4-[(3-pyrazol-1-ylphenyl)methyl]-1,4-diazepane (PubChem CID 70735219) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-cyclopentyl-4-[(3-pyrazol-1-ylphenyl)methyl]-1,4-diazepane.
| Compound Name | 1-cyclopentyl-4-[(3-pyrazol-1-ylphenyl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 70735219 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 1-cyclopentyl-4-[(3-pyrazol-1-ylphenyl)methyl]-1,4-diazepane |
| SMILES | c1cc(CN2CCCN(C3CCCC3)CC2)cc(-n2cccn2)c1 |
| InChI | InChI=1S/C20H28N4/c1-2-8-19(7-1)23-12-5-11-22(14-15-23)17-18-6-3-9-20(16-18)24-13-4-10-21-24/h3-4,6,9-10,13,16,19H,1-2,5,7-8,11-12,14-15,17H2 |
| InChIKey | ZVZVJUFOFMKMGP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |