C20H22N4 — CID 56913035
4-[1-[(3-pyrazol-1-ylphenyl)methyl]piperidin-4-yl]pyridine (PubChem CID 56913035) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[1-[(3-pyrazol-1-ylphenyl)methyl]piperidin-4-yl]pyridine.
| Compound Name | 4-[1-[(3-pyrazol-1-ylphenyl)methyl]piperidin-4-yl]pyridine |
|---|---|
| PubChem CID | 56913035 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-[1-[(3-pyrazol-1-ylphenyl)methyl]piperidin-4-yl]pyridine |
| SMILES | c1cc(CN2CCC(c3ccncc3)CC2)cc(-n2cccn2)c1 |
| InChI | InChI=1S/C20H22N4/c1-3-17(15-20(4-1)24-12-2-9-22-24)16-23-13-7-19(8-14-23)18-5-10-21-11-6-18/h1-6,9-12,15,19H,7-8,13-14,16H2 |
| InChIKey | MRIFSZCZTIOIPN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |