C21H31N3O — CID 70740687
(1S,5R)-3-[[3-(2-aminoethyl)phenyl]methyl]-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-7-one (PubChem CID 70740687) has the molecular formula C21H31N3O and a molecular weight of 341.50 g/mol. Its IUPAC name is (1S,5R)-3-[[3-(2-aminoethyl)phenyl]methyl]-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-7-one.
| Compound Name | (1S,5R)-3-[[3-(2-aminoethyl)phenyl]methyl]-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-7-one |
|---|---|
| PubChem CID | 70740687 |
| Molecular Formula | C21H31N3O |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | (1S,5R)-3-[[3-(2-aminoethyl)phenyl]methyl]-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-7-one |
| SMILES | CC(C)=CCN1C(=O)[C@H]2CC[C@@H]1CN(Cc1cccc(CCN)c1)C2 |
| InChI | InChI=1S/C21H31N3O/c1-16(2)9-11-24-20-7-6-19(21(24)25)14-23(15-20)13-18-5-3-4-17(12-18)8-10-22/h3-5,9,12,19-20H,6-8,10-11,13-15,22H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | VSNZNTHIKDUYLT-VQTJNVASSA-N |
| XLogP | 2.58 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|