C21H29N3O2 — CID 72838940
(1S,5R)-N-(2,5-dimethylphenyl)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide (PubChem CID 72838940) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is (1S,5R)-N-(2,5-dimethylphenyl)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide.
| Compound Name | (1S,5R)-N-(2,5-dimethylphenyl)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
|---|---|
| PubChem CID | 72838940 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | (1S,5R)-N-(2,5-dimethylphenyl)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonane-3-carboxamide |
| SMILES | CC(C)=CCN1C(=O)[C@H]2CC[C@@H]1CN(C(=O)Nc1cc(C)ccc1C)C2 |
| InChI | InChI=1S/C21H29N3O2/c1-14(2)9-10-24-18-8-7-17(20(24)25)12-23(13-18)21(26)22-19-11-15(3)5-6-16(19)4/h5-6,9,11,17-18H,7-8,10,12-13H2,1-4H3,(H,22,26)/t17-,18+/m0/s1 |
| InChIKey | IQFSXJKVWAYHRF-ZWKOTPCHSA-N |
| XLogP | 3.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|