C15H22N2O2 — CID 84528566
N-(2,5-dimethylphenyl)-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 84528566) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 84528566 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)N2CCCC(CO)C2)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-11-5-6-12(2)14(8-11)16-15(19)17-7-3-4-13(9-17)10-18/h5-6,8,13,18H,3-4,7,9-10H2,1-2H3,(H,16,19) |
| InChIKey | IGBRGCMDFPNPKQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |