C17H24N2O3S — CID 72889185
methyl 4-methyl-3-[[3-(methylsulfanylmethyl)piperidine-1-carbonyl]amino]benzoate (PubChem CID 72889185) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is methyl 4-methyl-3-[[3-(methylsulfanylmethyl)piperidine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 4-methyl-3-[[3-(methylsulfanylmethyl)piperidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 72889185 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | methyl 4-methyl-3-[[3-(methylsulfanylmethyl)piperidine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)N2CCCC(CSC)C2)c1 |
| InChI | InChI=1S/C17H24N2O3S/c1-12-6-7-14(16(20)22-2)9-15(12)18-17(21)19-8-4-5-13(10-19)11-23-3/h6-7,9,13H,4-5,8,10-11H2,1-3H3,(H,18,21) |
| InChIKey | CBGVBRZCFAGDNH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |