C22H27FN2O3 — CID 72874367
1-(4-fluorophenyl)-4-[(1S,5R)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]butane-1,4-dione (PubChem CID 72874367) has the molecular formula C22H27FN2O3 and a molecular weight of 386.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(1S,5R)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]butane-1,4-dione.
| Compound Name | 1-(4-fluorophenyl)-4-[(1S,5R)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 72874367 |
| Molecular Formula | C22H27FN2O3 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(1S,5R)-6-(3-methylbut-2-enyl)-7-oxo-3,6-diazabicyclo[3.2.2]nonan-3-yl]butane-1,4-dione |
| SMILES | CC(C)=CCN1C(=O)[C@H]2CC[C@@H]1CN(C(=O)CCC(=O)c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C22H27FN2O3/c1-15(2)11-12-25-19-8-5-17(22(25)28)13-24(14-19)21(27)10-9-20(26)16-3-6-18(23)7-4-16/h3-4,6-7,11,17,19H,5,8-10,12-14H2,1-2H3/t17-,19+/m0/s1 |
| InChIKey | WPMNPTBLIUOXQH-PKOBYXMFSA-N |
| XLogP | 3.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|