C17H20N4O2 — CID 75472637
(5S)-5-tert-butyl-3-[(3-pyrazol-1-ylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 75472637) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is (5S)-5-tert-butyl-3-[(3-pyrazol-1-ylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-tert-butyl-3-[(3-pyrazol-1-ylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75472637 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (5S)-5-tert-butyl-3-[(3-pyrazol-1-ylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | CC(C)(C)[C@@H]1NC(=O)N(Cc2cccc(-n3cccn3)c2)C1=O |
| InChI | InChI=1S/C17H20N4O2/c1-17(2,3)14-15(22)20(16(23)19-14)11-12-6-4-7-13(10-12)21-9-5-8-18-21/h4-10,14H,11H2,1-3H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | NLBNKHZDZNHQPO-CQSZACIVSA-N |
| XLogP | 2.34 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|