C24H27N3O3 — CID 174685596
6-(2,6-dimethoxyphenyl)-1-[(3-pyrazol-1-ylphenyl)methyl]piperidine-2-carbaldehyde (PubChem CID 174685596) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is 6-(2,6-dimethoxyphenyl)-1-[(3-pyrazol-1-ylphenyl)methyl]piperidine-2-carbaldehyde.
| Compound Name | 6-(2,6-dimethoxyphenyl)-1-[(3-pyrazol-1-ylphenyl)methyl]piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174685596 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 6-(2,6-dimethoxyphenyl)-1-[(3-pyrazol-1-ylphenyl)methyl]piperidine-2-carbaldehyde |
| SMILES | COc1cccc(OC)c1C1CCCC(C=O)N1Cc1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C24H27N3O3/c1-29-22-11-5-12-23(30-2)24(22)21-10-4-9-20(17-28)26(21)16-18-7-3-8-19(15-18)27-14-6-13-25-27/h3,5-8,11-15,17,20-21H,4,9-10,16H2,1-2H3 |
| InChIKey | WHEAXFZJEYNVIY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|