C25H28N2O3S — CID 174685602
7-(2,6-dimethoxyphenyl)-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]azepane-2-carbaldehyde (PubChem CID 174685602) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 7-(2,6-dimethoxyphenyl)-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]azepane-2-carbaldehyde.
| Compound Name | 7-(2,6-dimethoxyphenyl)-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]azepane-2-carbaldehyde |
|---|---|
| PubChem CID | 174685602 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 7-(2,6-dimethoxyphenyl)-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]azepane-2-carbaldehyde |
| SMILES | COc1cccc(OC)c1C1CCCCC(C=O)N1Cc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H28N2O3S/c1-29-22-13-8-14-23(30-2)24(22)21-12-7-6-11-20(16-28)27(21)15-19-17-31-25(26-19)18-9-4-3-5-10-18/h3-5,8-10,13-14,16-17,20-21H,6-7,11-12,15H2,1-2H3 |
| InChIKey | GZUKBAVOUAGIDK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|