C27H30N2O3 — CID 174685489
7-(2,6-dimethoxyphenyl)-1-[(3-pyridin-4-ylphenyl)methyl]azepane-2-carbaldehyde (PubChem CID 174685489) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is 7-(2,6-dimethoxyphenyl)-1-[(3-pyridin-4-ylphenyl)methyl]azepane-2-carbaldehyde.
| Compound Name | 7-(2,6-dimethoxyphenyl)-1-[(3-pyridin-4-ylphenyl)methyl]azepane-2-carbaldehyde |
|---|---|
| PubChem CID | 174685489 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 7-(2,6-dimethoxyphenyl)-1-[(3-pyridin-4-ylphenyl)methyl]azepane-2-carbaldehyde |
| SMILES | COc1cccc(OC)c1C1CCCCC(C=O)N1Cc1cccc(-c2ccncc2)c1 |
| InChI | InChI=1S/C27H30N2O3/c1-31-25-11-6-12-26(32-2)27(25)24-10-4-3-9-23(19-30)29(24)18-20-7-5-8-22(17-20)21-13-15-28-16-14-21/h5-8,11-17,19,23-24H,3-4,9-10,18H2,1-2H3 |
| InChIKey | WMYIPEJVWMYHFJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|