C24H28N4O3 — CID 174685486
7-(2,6-dimethoxyphenyl)-1-[[3-(triazol-2-yl)phenyl]methyl]azepane-2-carbaldehyde (PubChem CID 174685486) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 7-(2,6-dimethoxyphenyl)-1-[[3-(triazol-2-yl)phenyl]methyl]azepane-2-carbaldehyde.
| Compound Name | 7-(2,6-dimethoxyphenyl)-1-[[3-(triazol-2-yl)phenyl]methyl]azepane-2-carbaldehyde |
|---|---|
| PubChem CID | 174685486 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 7-(2,6-dimethoxyphenyl)-1-[[3-(triazol-2-yl)phenyl]methyl]azepane-2-carbaldehyde |
| SMILES | COc1cccc(OC)c1C1CCCCC(C=O)N1Cc1cccc(-n2nccn2)c1 |
| InChI | InChI=1S/C24H28N4O3/c1-30-22-11-6-12-23(31-2)24(22)21-10-4-3-8-20(17-29)27(21)16-18-7-5-9-19(15-18)28-25-13-14-26-28/h5-7,9,11-15,17,20-21H,3-4,8,10,16H2,1-2H3 |
| InChIKey | SKEOAOICPATJND-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|