C23H27F3N2O4 — CID 174685519
6-[4-(aminomethyl)-2,6-dimethoxyphenyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-2-carbaldehyde (PubChem CID 174685519) has the molecular formula C23H27F3N2O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 6-[4-(aminomethyl)-2,6-dimethoxyphenyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-2-carbaldehyde.
| Compound Name | 6-[4-(aminomethyl)-2,6-dimethoxyphenyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174685519 |
| Molecular Formula | C23H27F3N2O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 6-[4-(aminomethyl)-2,6-dimethoxyphenyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidine-2-carbaldehyde |
| SMILES | COc1cc(CN)cc(OC)c1C1CCCC(C=O)N1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H27F3N2O4/c1-30-20-10-16(12-27)11-21(31-2)22(20)19-5-3-4-17(14-29)28(19)13-15-6-8-18(9-7-15)32-23(24,25)26/h6-11,14,17,19H,3-5,12-13,27H2,1-2H3 |
| InChIKey | UZZCVSCSVINLMP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|