C21H23F3N2O4 — CID 174685561
6-(2,6-dimethoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-2-carbaldehyde (PubChem CID 174685561) has the molecular formula C21H23F3N2O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is 6-(2,6-dimethoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-2-carbaldehyde.
| Compound Name | 6-(2,6-dimethoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174685561 |
| Molecular Formula | C21H23F3N2O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 6-(2,6-dimethoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]piperazine-2-carbaldehyde |
| SMILES | COc1cccc(OC)c1C1CNCC(C=O)N1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H23F3N2O4/c1-28-18-4-3-5-19(29-2)20(18)17-11-25-10-15(13-27)26(17)12-14-6-8-16(9-7-14)30-21(22,23)24/h3-9,13,15,17,25H,10-12H2,1-2H3 |
| InChIKey | PJWXMTUFIJAPSK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|