C19H16ClF4NO3 — CID 69082773
(3S,5S)-3-chloro-5-(2-fluoro-6-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one (PubChem CID 69082773) has the molecular formula C19H16ClF4NO3 and a molecular weight of 417.79 g/mol. Its IUPAC name is (3S,5S)-3-chloro-5-(2-fluoro-6-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | (3S,5S)-3-chloro-5-(2-fluoro-6-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 69082773 |
| Molecular Formula | C19H16ClF4NO3 |
| Molecular Weight | 417.79 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (3S,5S)-3-chloro-5-(2-fluoro-6-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one |
| SMILES | COc1cccc(F)c1[C@@H]1C[C@H](Cl)C(=O)N1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16ClF4NO3/c1-27-16-4-2-3-14(21)17(16)15-9-13(20)18(26)25(15)10-11-5-7-12(8-6-11)28-19(22,23)24/h2-8,13,15H,9-10H2,1H3/t13-,15-/m0/s1 |
| InChIKey | NXXKGTAACDQFCQ-ZFWWWQNUSA-N |
| XLogP | 4.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|