C20H17ClF5NO3 — CID 123533148
(3S,5R)-3-chloro-5-(2-ethoxy-4,6-difluorophenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one (PubChem CID 123533148) has the molecular formula C20H17ClF5NO3 and a molecular weight of 449.80 g/mol. Its IUPAC name is (3S,5R)-3-chloro-5-(2-ethoxy-4,6-difluorophenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | (3S,5R)-3-chloro-5-(2-ethoxy-4,6-difluorophenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123533148 |
| Molecular Formula | C20H17ClF5NO3 |
| Molecular Weight | 449.80 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | (3S,5R)-3-chloro-5-(2-ethoxy-4,6-difluorophenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one |
| SMILES | CCOc1cc(F)cc(F)c1[C@H]1C[C@H](Cl)C(=O)N1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17ClF5NO3/c1-2-29-17-8-12(22)7-15(23)18(17)16-9-14(21)19(28)27(16)10-11-3-5-13(6-4-11)30-20(24,25)26/h3-8,14,16H,2,9-10H2,1H3/t14-,16+/m0/s1 |
| InChIKey | IVKCYEBYENKDQT-GOEBONIOSA-N |
| XLogP | 5.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.80 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|