C23H26F3NO5 — CID 69080237
6-[2-(3-hydroxypropoxy)-6-methoxyphenyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-2-one (PubChem CID 69080237) has the molecular formula C23H26F3NO5 and a molecular weight of 453.46 g/mol. Its IUPAC name is 6-[2-(3-hydroxypropoxy)-6-methoxyphenyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-2-one.
| Compound Name | 6-[2-(3-hydroxypropoxy)-6-methoxyphenyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 69080237 |
| Molecular Formula | C23H26F3NO5 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 6-[2-(3-hydroxypropoxy)-6-methoxyphenyl]-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-2-one |
| SMILES | COc1cccc(OCCCO)c1C1CCCC(=O)N1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H26F3NO5/c1-30-19-6-3-7-20(31-14-4-13-28)22(19)18-5-2-8-21(29)27(18)15-16-9-11-17(12-10-16)32-23(24,25)26/h3,6-7,9-12,18,28H,2,4-5,8,13-15H2,1H3 |
| InChIKey | ZSCTYCBCYVLJKU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|