C20H20F3NO3 — CID 69082267
6-(2-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-2-one (PubChem CID 69082267) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-2-one.
| Compound Name | 6-(2-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 69082267 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 6-(2-methoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-2-one |
| SMILES | COc1ccccc1C1CCCC(=O)N1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO3/c1-26-18-7-3-2-5-16(18)17-6-4-8-19(25)24(17)13-14-9-11-15(12-10-14)27-20(21,22)23/h2-3,5,7,9-12,17H,4,6,8,13H2,1H3 |
| InChIKey | QMSRDMGRZNPQED-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |