C26H27FN2O3 — CID 174697802
6-(2,6-dimethoxyphenyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidine-2-carbaldehyde (PubChem CID 174697802) has the molecular formula C26H27FN2O3 and a molecular weight of 434.51 g/mol. Its IUPAC name is 6-(2,6-dimethoxyphenyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidine-2-carbaldehyde.
| Compound Name | 6-(2,6-dimethoxyphenyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174697802 |
| Molecular Formula | C26H27FN2O3 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 6-(2,6-dimethoxyphenyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidine-2-carbaldehyde |
| SMILES | COc1cccc(OC)c1C1CCCC(C=O)N1Cc1ccc(F)c(-c2ccccn2)c1 |
| InChI | InChI=1S/C26H27FN2O3/c1-31-24-10-6-11-25(32-2)26(24)23-9-5-7-19(17-30)29(23)16-18-12-13-21(27)20(15-18)22-8-3-4-14-28-22/h3-4,6,8,10-15,17,19,23H,5,7,9,16H2,1-2H3 |
| InChIKey | OPILNSROUQGCFD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|