C21H24F2N2O4 — CID 174697688
1-[[5-(difluoromethoxy)-2-pyridinyl]methyl]-6-(2,6-dimethoxyphenyl)piperidine-2-carbaldehyde (PubChem CID 174697688) has the molecular formula C21H24F2N2O4 and a molecular weight of 406.43 g/mol. Its IUPAC name is 1-[[5-(difluoromethoxy)-2-pyridinyl]methyl]-6-(2,6-dimethoxyphenyl)piperidine-2-carbaldehyde.
| Compound Name | 1-[[5-(difluoromethoxy)-2-pyridinyl]methyl]-6-(2,6-dimethoxyphenyl)piperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174697688 |
| Molecular Formula | C21H24F2N2O4 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-[[5-(difluoromethoxy)-2-pyridinyl]methyl]-6-(2,6-dimethoxyphenyl)piperidine-2-carbaldehyde |
| SMILES | COc1cccc(OC)c1C1CCCC(C=O)N1Cc1ccc(OC(F)F)cn1 |
| InChI | InChI=1S/C21H24F2N2O4/c1-27-18-7-4-8-19(28-2)20(18)17-6-3-5-15(13-26)25(17)12-14-9-10-16(11-24-14)29-21(22)23/h4,7-11,13,15,17,21H,3,5-6,12H2,1-2H3 |
| InChIKey | GOBSOZAXSMHNKA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|