C23H27F2NO4 — CID 174697864
1-[[4-(2,2-difluoroethoxy)phenyl]methyl]-5-(2,6-dimethoxyphenyl)-3-methylpyrrolidine-2-carbaldehyde (PubChem CID 174697864) has the molecular formula C23H27F2NO4 and a molecular weight of 419.47 g/mol. Its IUPAC name is 1-[[4-(2,2-difluoroethoxy)phenyl]methyl]-5-(2,6-dimethoxyphenyl)-3-methylpyrrolidine-2-carbaldehyde.
| Compound Name | 1-[[4-(2,2-difluoroethoxy)phenyl]methyl]-5-(2,6-dimethoxyphenyl)-3-methylpyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174697864 |
| Molecular Formula | C23H27F2NO4 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 1-[[4-(2,2-difluoroethoxy)phenyl]methyl]-5-(2,6-dimethoxyphenyl)-3-methylpyrrolidine-2-carbaldehyde |
| SMILES | COc1cccc(OC)c1C1CC(C)C(C=O)N1Cc1ccc(OCC(F)F)cc1 |
| InChI | InChI=1S/C23H27F2NO4/c1-15-11-18(23-20(28-2)5-4-6-21(23)29-3)26(19(15)13-27)12-16-7-9-17(10-8-16)30-14-22(24)25/h4-10,13,15,18-19,22H,11-12,14H2,1-3H3 |
| InChIKey | OMYGAPBHUPNOOF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|