C25H26N2O3 — CID 69085337
6-(2,6-dimethoxyphenyl)-1-[(4-phenyl-2-pyridinyl)methyl]piperidin-2-one (PubChem CID 69085337) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 6-(2,6-dimethoxyphenyl)-1-[(4-phenyl-2-pyridinyl)methyl]piperidin-2-one.
| Compound Name | 6-(2,6-dimethoxyphenyl)-1-[(4-phenyl-2-pyridinyl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 69085337 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 6-(2,6-dimethoxyphenyl)-1-[(4-phenyl-2-pyridinyl)methyl]piperidin-2-one |
| SMILES | COc1cccc(OC)c1C1CCCC(=O)N1Cc1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C25H26N2O3/c1-29-22-11-7-12-23(30-2)25(22)21-10-6-13-24(28)27(21)17-20-16-19(14-15-26-20)18-8-4-3-5-9-18/h3-5,7-9,11-12,14-16,21H,6,10,13,17H2,1-2H3 |
| InChIKey | ZKGNZWCAJMKJBM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |