C25H25NO4 — CID 69083465
5-(2,6-dimethoxyphenyl)-1-[(3-phenoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 69083465) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-(2,6-dimethoxyphenyl)-1-[(3-phenoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 5-(2,6-dimethoxyphenyl)-1-[(3-phenoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 69083465 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 5-(2,6-dimethoxyphenyl)-1-[(3-phenoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1cccc(OC)c1C1CCC(=O)N1Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C25H25NO4/c1-28-22-12-7-13-23(29-2)25(22)21-14-15-24(27)26(21)17-18-8-6-11-20(16-18)30-19-9-4-3-5-10-19/h3-13,16,21H,14-15,17H2,1-2H3 |
| InChIKey | MDWAKJNHSDZNKH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |