C19H23ClN2O2S — CID 172668222
N-[(3aS,5R,6R,7aR)-2-[(3-chloro-1-benzothiophen-2-yl)methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide (PubChem CID 172668222) has the molecular formula C19H23ClN2O2S and a molecular weight of 378.93 g/mol. Its IUPAC name is N-[(3aS,5R,6R,7aR)-2-[(3-chloro-1-benzothiophen-2-yl)methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide.
| Compound Name | N-[(3aS,5R,6R,7aR)-2-[(3-chloro-1-benzothiophen-2-yl)methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 172668222 |
| Molecular Formula | C19H23ClN2O2S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[(3aS,5R,6R,7aR)-2-[(3-chloro-1-benzothiophen-2-yl)methyl]-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C[C@@H]2CN(Cc3sc4ccccc4c3Cl)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C19H23ClN2O2S/c1-11(23)21-15-6-12-8-22(9-13(12)7-16(15)24)10-18-19(20)14-4-2-3-5-17(14)25-18/h2-5,12-13,15-16,24H,6-10H2,1H3,(H,21,23)/t12-,13+,15-,16-/m1/s1 |
| InChIKey | WITSNZYXPHETBW-OCVGTWLNSA-N |
| XLogP | 3.26 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |