C14H15Cl2NO2S — CID 119903920
1-[(3-chloro-1-benzothiophen-2-yl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 119903920) has the molecular formula C14H15Cl2NO2S and a molecular weight of 332.25 g/mol. Its IUPAC name is 1-[(3-chloro-1-benzothiophen-2-yl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[(3-chloro-1-benzothiophen-2-yl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119903920 |
| Molecular Formula | C14H15Cl2NO2S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 1-[(3-chloro-1-benzothiophen-2-yl)methyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)C1CCN(Cc2sc3ccccc3c2Cl)C1 |
| InChI | InChI=1S/C14H14ClNO2S.ClH/c15-13-10-3-1-2-4-11(10)19-12(13)8-16-6-5-9(7-16)14(17)18;/h1-4,9H,5-8H2,(H,17,18);1H |
| InChIKey | QKZTUXXBKUOUBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |