C21H21ClN2OS — CID 33109099
N-[1-[(3-chloro-1-benzothiophen-2-yl)methyl]piperidin-4-yl]benzamide (PubChem CID 33109099) has the molecular formula C21H21ClN2OS and a molecular weight of 384.93 g/mol. Its IUPAC name is N-[1-[(3-chloro-1-benzothiophen-2-yl)methyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[(3-chloro-1-benzothiophen-2-yl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 33109099 |
| Molecular Formula | C21H21ClN2OS |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[1-[(3-chloro-1-benzothiophen-2-yl)methyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(Cc2sc3ccccc3c2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H21ClN2OS/c22-20-17-8-4-5-9-18(17)26-19(20)14-24-12-10-16(11-13-24)23-21(25)15-6-2-1-3-7-15/h1-9,16H,10-14H2,(H,23,25) |
| InChIKey | MUCOKHOEWLZVBY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |