C15H19ClN2O2S2 — CID 55464036
1-[(3-chloro-1-benzothiophen-2-yl)methyl]-4-ethylsulfonylpiperazine (PubChem CID 55464036) has the molecular formula C15H19ClN2O2S2 and a molecular weight of 358.92 g/mol. Its IUPAC name is 1-[(3-chloro-1-benzothiophen-2-yl)methyl]-4-ethylsulfonylpiperazine.
| Compound Name | 1-[(3-chloro-1-benzothiophen-2-yl)methyl]-4-ethylsulfonylpiperazine |
|---|---|
| PubChem CID | 55464036 |
| Molecular Formula | C15H19ClN2O2S2 |
| Molecular Weight | 358.92 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-[(3-chloro-1-benzothiophen-2-yl)methyl]-4-ethylsulfonylpiperazine |
| SMILES | CCS(=O)(=O)N1CCN(Cc2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C15H19ClN2O2S2/c1-2-22(19,20)18-9-7-17(8-10-18)11-14-15(16)12-5-3-4-6-13(12)21-14/h3-6H,2,7-11H2,1H3 |
| InChIKey | AZCDZHCEBYUAKO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.92 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |