C20H22Cl2N2O2 — CID 33104635
N-[1-[2-(2,6-dichlorophenoxy)ethyl]piperidin-4-yl]benzamide (PubChem CID 33104635) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is N-[1-[2-(2,6-dichlorophenoxy)ethyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[2-(2,6-dichlorophenoxy)ethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 33104635 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[1-[2-(2,6-dichlorophenoxy)ethyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(CCOc2c(Cl)cccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c21-17-7-4-8-18(22)19(17)26-14-13-24-11-9-16(10-12-24)23-20(25)15-5-2-1-3-6-15/h1-8,16H,9-14H2,(H,23,25) |
| InChIKey | RPYBDBLXKLHJDQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |