C18H21ClN2O3S — CID 71895628
(3-chloro-1-benzothiophen-2-yl)methyl 1-(dimethylcarbamoyl)piperidine-4-carboxylate (PubChem CID 71895628) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is (3-chloro-1-benzothiophen-2-yl)methyl 1-(dimethylcarbamoyl)piperidine-4-carboxylate.
| Compound Name | (3-chloro-1-benzothiophen-2-yl)methyl 1-(dimethylcarbamoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 71895628 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (3-chloro-1-benzothiophen-2-yl)methyl 1-(dimethylcarbamoyl)piperidine-4-carboxylate |
| SMILES | CN(C)C(=O)N1CCC(C(=O)OCc2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C18H21ClN2O3S/c1-20(2)18(23)21-9-7-12(8-10-21)17(22)24-11-15-16(19)13-5-3-4-6-14(13)25-15/h3-6,12H,7-11H2,1-2H3 |
| InChIKey | KCFYRKMXMHILPO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |