C17H21ClN2OS — CID 34415077
(2S)-1-[(3-chloro-1-benzothiophen-2-yl)methyl]-N-propylpyrrolidine-2-carboxamide (PubChem CID 34415077) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is (2S)-1-[(3-chloro-1-benzothiophen-2-yl)methyl]-N-propylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(3-chloro-1-benzothiophen-2-yl)methyl]-N-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 34415077 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2S)-1-[(3-chloro-1-benzothiophen-2-yl)methyl]-N-propylpyrrolidine-2-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1CCCN1Cc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C17H21ClN2OS/c1-2-9-19-17(21)13-7-5-10-20(13)11-15-16(18)12-6-3-4-8-14(12)22-15/h3-4,6,8,13H,2,5,7,9-11H2,1H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | RVPUOFAINKVUCZ-ZDUSSCGKSA-N |
| XLogP | 4.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |