C14H14ClNO2S2 — CID 82905466
4-[(3-chloro-1-benzothiophen-2-yl)methyl]thiomorpholine-3-carboxylic acid (PubChem CID 82905466) has the molecular formula C14H14ClNO2S2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 4-[(3-chloro-1-benzothiophen-2-yl)methyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[(3-chloro-1-benzothiophen-2-yl)methyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 82905466 |
| Molecular Formula | C14H14ClNO2S2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 4-[(3-chloro-1-benzothiophen-2-yl)methyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1Cc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C14H14ClNO2S2/c15-13-9-3-1-2-4-11(9)20-12(13)7-16-5-6-19-8-10(16)14(17)18/h1-4,10H,5-8H2,(H,17,18) |
| InChIKey | JUVAFNQYLZJQQR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |